C15H17NO4 — CID 141377417
ethyl (2S,3R)-2-[(4-ethynylbenzoyl)amino]-3-hydroxybutanoate (PubChem CID 141377417) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is ethyl (2S,3R)-2-[(4-ethynylbenzoyl)amino]-3-hydroxybutanoate.
| Compound Name | ethyl (2S,3R)-2-[(4-ethynylbenzoyl)amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 141377417 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | ethyl (2S,3R)-2-[(4-ethynylbenzoyl)amino]-3-hydroxybutanoate |
| SMILES | C#Cc1ccc(C(=O)N[C@H](C(=O)OCC)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C15H17NO4/c1-4-11-6-8-12(9-7-11)14(18)16-13(10(3)17)15(19)20-5-2/h1,6-10,13,17H,5H2,2-3H3,(H,16,18)/t10-,13+/m1/s1 |
| InChIKey | AFDZZSUXEMHFGL-MFKMUULPSA-N |
| XLogP | 0.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|