C24H36N2O3 — CID 87502931
N-[(2S)-2-(decoxyamino)-3-methylbutanoyl]-4-ethynylbenzamide (PubChem CID 87502931) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is N-[(2S)-2-(decoxyamino)-3-methylbutanoyl]-4-ethynylbenzamide.
| Compound Name | N-[(2S)-2-(decoxyamino)-3-methylbutanoyl]-4-ethynylbenzamide |
|---|---|
| PubChem CID | 87502931 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | N-[(2S)-2-(decoxyamino)-3-methylbutanoyl]-4-ethynylbenzamide |
| SMILES | C#Cc1ccc(C(=O)NC(=O)[C@@H](NOCCCCCCCCCC)C(C)C)cc1 |
| InChI | InChI=1S/C24H36N2O3/c1-5-7-8-9-10-11-12-13-18-29-26-22(19(3)4)24(28)25-23(27)21-16-14-20(6-2)15-17-21/h2,14-17,19,22,26H,5,7-13,18H2,1,3-4H3,(H,25,27,28)/t22-/m0/s1 |
| InChIKey | PIBUMKBQCDJDQX-QFIPXVFZSA-N |
| XLogP | 4.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|