C25H38N2O2 — CID 59008327
N-[(2S,3S)-1-(4-ethynylanilino)-3-methyl-1-oxopentan-2-yl]undecanamide (PubChem CID 59008327) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is N-[(2S,3S)-1-(4-ethynylanilino)-3-methyl-1-oxopentan-2-yl]undecanamide.
| Compound Name | N-[(2S,3S)-1-(4-ethynylanilino)-3-methyl-1-oxopentan-2-yl]undecanamide |
|---|---|
| PubChem CID | 59008327 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | N-[(2S,3S)-1-(4-ethynylanilino)-3-methyl-1-oxopentan-2-yl]undecanamide |
| SMILES | C#Cc1ccc(NC(=O)[C@@H](NC(=O)CCCCCCCCCC)[C@@H](C)CC)cc1 |
| InChI | InChI=1S/C25H38N2O2/c1-5-8-9-10-11-12-13-14-15-23(28)27-24(20(4)6-2)25(29)26-22-18-16-21(7-3)17-19-22/h3,16-20,24H,5-6,8-15H2,1-2,4H3,(H,26,29)(H,27,28)/t20-,24-/m0/s1 |
| InChIKey | UNKPDKQBPQIDCY-RDPSFJRHSA-N |
| XLogP | 5.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|