C21H41NO3 — CID 10196275
(2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid (PubChem CID 10196275) has the molecular formula C21H41NO3 and a molecular weight of 355.56 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 10196275 |
| Molecular Formula | C21H41NO3 |
| Molecular Weight | 355.56 g/mol |
| Exact Mass | 355.31 |
| IUPAC Name | (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid |
| SMILES | CCCCCCCCCCCCCCC(=O)N[C@H](C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C21H41NO3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-19(23)22-20(21(24)25)18(3)5-2/h18,20H,4-17H2,1-3H3,(H,22,23)(H,24,25)/t18-,20-/m0/s1 |
| InChIKey | YEGKGKFXTYHKIE-ICSRJNTNSA-N |
| XLogP | 5.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|