(2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid

C21H41NO3 — CID 10196275

IUPAC(2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid
SMILESCCCCCCCCCCCCCCC(=O)N[C@H](C(=O)O)[C@@H](C)CC
InChIInChI=1S/C21H41NO3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-19(23)22-20(21(24)25)18(3)5-2/h18,20H,4-17H2,1-3H3,(H,22,23)(H,24,25)/t18-,20-/m0/s1
InChIKeyYEGKGKFXTYHKIE-ICSRJNTNSA-N
MW355.56 g/mol
LogP5.69
Rot. Bonds17

About (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid

(2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid (PubChem CID 10196275) has the molecular formula C21H41NO3 and a molecular weight of 355.56 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid.

Molecular Properties

Compound Name(2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid
PubChem CID10196275
Molecular FormulaC21H41NO3
Molecular Weight355.56 g/mol
Exact Mass355.31
IUPAC Name(2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid
SMILESCCCCCCCCCCCCCCC(=O)N[C@H](C(=O)O)[C@@H](C)CC
InChIInChI=1S/C21H41NO3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-19(23)22-20(21(24)25)18(3)5-2/h18,20H,4-17H2,1-3H3,(H,22,23)(H,24,25)/t18-,20-/m0/s1
InChIKeyYEGKGKFXTYHKIE-ICSRJNTNSA-N
XLogP5.69
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds17
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500355.56
LogP ≤ 55.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid?
The IUPAC name of (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid (CID 10196275) is (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid.
What is the SMILES notation for (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid?
The canonical SMILES for (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid is CCCCCCCCCCCCCCC(=O)N[C@H](C(=O)O)[C@@H](C)CC.
What is the InChIKey of (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid?
The InChIKey is YEGKGKFXTYHKIE-ICSRJNTNSA-N. The full InChI is InChI=1S/C21H41NO3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-19(23)22-20(21(24)25)18(3)5-2/h18,20H,4-17H2,1-3H3,(H,22,23)(H,24,25)/t18-,20-/m0/s1.
What are the key properties of (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid?
(2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid has a molecular weight of 355.56 g/mol, XLogP of 5.69, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-methyl-2-(pentadecanoylamino)pentanoic acid is sourced from PubChem (CID 10196275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).