C24H43NO3 — CID 156963047
3-methyl-2-[[(9E,12E)-octadeca-9,12-dienoyl]amino]pentanoic acid (PubChem CID 156963047) has the molecular formula C24H43NO3 and a molecular weight of 393.61 g/mol. Its IUPAC name is 3-methyl-2-[[(9E,12E)-octadeca-9,12-dienoyl]amino]pentanoic acid.
| Compound Name | 3-methyl-2-[[(9E,12E)-octadeca-9,12-dienoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 156963047 |
| Molecular Formula | C24H43NO3 |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 393.32 |
| IUPAC Name | 3-methyl-2-[[(9E,12E)-octadeca-9,12-dienoyl]amino]pentanoic acid |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)NC(C(=O)O)C(C)CC |
| InChI | InChI=1S/C24H43NO3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(26)25-23(24(27)28)21(3)5-2/h9-10,12-13,21,23H,4-8,11,14-20H2,1-3H3,(H,25,26)(H,27,28)/b10-9+,13-12+ |
| InChIKey | NLHYAAGTDKOGDG-OKLKQMLOSA-N |
| XLogP | 6.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|