C24H47NO2 — CID 141489273
(2S,3S)-3-methyl-2-[[(Z)-octadec-9-enyl]amino]pentanoic acid (PubChem CID 141489273) has the molecular formula C24H47NO2 and a molecular weight of 381.65 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[[(Z)-octadec-9-enyl]amino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[[(Z)-octadec-9-enyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 141489273 |
| Molecular Formula | C24H47NO2 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.36 |
| IUPAC Name | (2S,3S)-3-methyl-2-[[(Z)-octadec-9-enyl]amino]pentanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN[C@H](C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C24H47NO2/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-23(24(26)27)22(3)5-2/h12-13,22-23,25H,4-11,14-21H2,1-3H3,(H,26,27)/b13-12-/t22-,23-/m0/s1 |
| InChIKey | GMMFQJYAPNOXBT-HJCBPWMVSA-N |
| XLogP | 7.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|