C21H41NO2S — CID 54270433
(2R)-2-(octadec-9-enylamino)-3-sulfanylpropanoic acid (PubChem CID 54270433) has the molecular formula C21H41NO2S and a molecular weight of 371.63 g/mol. Its IUPAC name is (2R)-2-(octadec-9-enylamino)-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-(octadec-9-enylamino)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 54270433 |
| Molecular Formula | C21H41NO2S |
| Molecular Weight | 371.63 g/mol |
| Exact Mass | 371.29 |
| IUPAC Name | (2R)-2-(octadec-9-enylamino)-3-sulfanylpropanoic acid |
| SMILES | CCCCCCCCC=CCCCCCCCCN[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C21H41NO2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-20(19-25)21(23)24/h9-10,20,22,25H,2-8,11-19H2,1H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | RJSOBKZVONCIHO-FQEVSTJZSA-N |
| XLogP | 6.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|