About 2-(dodecylamino)hexanoic acid
2-(dodecylamino)hexanoic acid (PubChem CID 139637216) has the molecular formula C18H37NO2
and a molecular weight of 299.50 g/mol. Its IUPAC name is 2-(dodecylamino)hexanoic acid.
Molecular Properties
| Compound Name | 2-(dodecylamino)hexanoic acid |
| PubChem CID | 139637216 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | 2-(dodecylamino)hexanoic acid |
| SMILES | CCCCCCCCCCCCNC(CCCC)C(=O)O |
| InChI | InChI=1S/C18H37NO2/c1-3-5-7-8-9-10-11-12-13-14-16-19-17(18(20)21)15-6-4-2/h17,19H,3-16H2,1-2H3,(H,20,21) |
| InChIKey | FLBBUBBHMRUITQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(dodecylamino)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dodecylamino)hexanoic acid?
The IUPAC name of 2-(dodecylamino)hexanoic acid (CID 139637216) is 2-(dodecylamino)hexanoic acid.
What is the SMILES notation for 2-(dodecylamino)hexanoic acid?
The canonical SMILES for 2-(dodecylamino)hexanoic acid is CCCCCCCCCCCCNC(CCCC)C(=O)O.
What is the InChIKey of 2-(dodecylamino)hexanoic acid?
The InChIKey is FLBBUBBHMRUITQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO2/c1-3-5-7-8-9-10-11-12-13-14-16-19-17(18(20)21)15-6-4-2/h17,19H,3-16H2,1-2H3,(H,20,21).
What are the key properties of 2-(dodecylamino)hexanoic acid?
2-(dodecylamino)hexanoic acid has a molecular weight of 299.50 g/mol, XLogP of 5.14, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dodecylamino)hexanoic acid is sourced from PubChem (CID 139637216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).