C21H42NNaO4 — CID 174767967
sodium;(2S)-2-(hexadecylamino)pentanedioic acid;hydride (PubChem CID 174767967) has the molecular formula C21H42NNaO4 and a molecular weight of 395.56 g/mol. Its IUPAC name is sodium;(2S)-2-(hexadecylamino)pentanedioic acid;hydride.
| Compound Name | sodium;(2S)-2-(hexadecylamino)pentanedioic acid;hydride |
|---|---|
| PubChem CID | 174767967 |
| Molecular Formula | C21H42NNaO4 |
| Molecular Weight | 395.56 g/mol |
| Exact Mass | 395.30 |
| IUPAC Name | sodium;(2S)-2-(hexadecylamino)pentanedioic acid;hydride |
| SMILES | CCCCCCCCCCCCCCCCN[C@@H](CCC(=O)O)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C21H41NO4.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-22-19(21(25)26)16-17-20(23)24;;/h19,22H,2-18H2,1H3,(H,23,24)(H,25,26);;/q;+1;-1/t19-;;/m0../s1 |
| InChIKey | JDWHECLAEJMBRI-TXEPZDRESA-N |
| XLogP | 2.49 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|