C25H47NO4 — CID 151267787
(2S)-2-[[(Z)-icos-11-enyl]amino]pentanedioic acid (PubChem CID 151267787) has the molecular formula C25H47NO4 and a molecular weight of 425.65 g/mol. Its IUPAC name is (2S)-2-[[(Z)-icos-11-enyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(Z)-icos-11-enyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 151267787 |
| Molecular Formula | C25H47NO4 |
| Molecular Weight | 425.65 g/mol |
| Exact Mass | 425.35 |
| IUPAC Name | (2S)-2-[[(Z)-icos-11-enyl]amino]pentanedioic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCCN[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H47NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-26-23(25(29)30)20-21-24(27)28/h9-10,23,26H,2-8,11-22H2,1H3,(H,27,28)(H,29,30)/b10-9-/t23-/m0/s1 |
| InChIKey | NVSAPGOHHCPORY-AXKWSIDASA-N |
| XLogP | 6.71 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.65 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|