2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid

C24H39NO2 — CID 123884869

IUPAC2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid
SMILESCCC=CCC=CCC=CCC=CCC=CCCCCNC(CC)C(=O)O
InChIInChI=1S/C24H39NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-23(4-2)24(26)27/h5-6,8-9,11-12,14-15,17-18,23,25H,3-4,7,10,13,16,19-22H2,1-2H3,(H,26,27)
InChIKeySABYMGAFHDJWRE-UHFFFAOYSA-N
MW373.58 g/mol
LogP6.36
Rot. Bonds17

About 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid

2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid (PubChem CID 123884869) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid.

Molecular Properties

Compound Name2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid
PubChem CID123884869
Molecular FormulaC24H39NO2
Molecular Weight373.58 g/mol
Exact Mass373.30
IUPAC Name2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid
SMILESCCC=CCC=CCC=CCC=CCC=CCCCCNC(CC)C(=O)O
InChIInChI=1S/C24H39NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-23(4-2)24(26)27/h5-6,8-9,11-12,14-15,17-18,23,25H,3-4,7,10,13,16,19-22H2,1-2H3,(H,26,27)
InChIKeySABYMGAFHDJWRE-UHFFFAOYSA-N
XLogP6.36
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds17
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500373.58
LogP ≤ 56.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid?
The IUPAC name of 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid (CID 123884869) is 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid.
What is the SMILES notation for 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid?
The canonical SMILES for 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid is CCC=CCC=CCC=CCC=CCC=CCCCCNC(CC)C(=O)O.
What is the InChIKey of 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid?
The InChIKey is SABYMGAFHDJWRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H39NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-23(4-2)24(26)27/h5-6,8-9,11-12,14-15,17-18,23,25H,3-4,7,10,13,16,19-22H2,1-2H3,(H,26,27).
What are the key properties of 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid?
2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid has a molecular weight of 373.58 g/mol, XLogP of 6.36, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid is sourced from PubChem (CID 123884869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).