C24H39NO2 — CID 123884869
2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid (PubChem CID 123884869) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid.
| Compound Name | 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid |
|---|---|
| PubChem CID | 123884869 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | 2-(icosa-5,8,11,14,17-pentaenylamino)butanoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCNC(CC)C(=O)O |
| InChI | InChI=1S/C24H39NO2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-23(4-2)24(26)27/h5-6,8-9,11-12,14-15,17-18,23,25H,3-4,7,10,13,16,19-22H2,1-2H3,(H,26,27) |
| InChIKey | SABYMGAFHDJWRE-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|