C24H38O2 — CID 87220855
(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18,21-pentaenoic acid (PubChem CID 87220855) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18,21-pentaenoic acid.
| Compound Name | (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18,21-pentaenoic acid |
|---|---|
| PubChem CID | 87220855 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18,21-pentaenoic acid |
| SMILES | CCC=CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C24H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-23H2,1H3,(H,25,26)/b4-3?,7-6-,10-9-,13-12-,16-15- |
| InChIKey | NPTIBOCVSPURCS-SQUPTXSOSA-N |
| XLogP | 7.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|