C28H44O2 — CID 75955160
octacosa-10,13,16,19,22,25-hexaenoic acid (PubChem CID 75955160) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is octacosa-10,13,16,19,22,25-hexaenoic acid.
| Compound Name | octacosa-10,13,16,19,22,25-hexaenoic acid |
|---|---|
| PubChem CID | 75955160 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | octacosa-10,13,16,19,22,25-hexaenoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C28H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28(29)30/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-27H2,1H3,(H,29,30) |
| InChIKey | BQXYAHWVQOZPTF-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|