octacosa-10,13,16,19,22,25-hexaenoic acid

C28H44O2 — CID 75955160

IUPACoctacosa-10,13,16,19,22,25-hexaenoic acid
SMILESCCC=CCC=CCC=CCC=CCC=CCC=CCCCCCCCCC(=O)O
InChIInChI=1S/C28H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28(29)30/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-27H2,1H3,(H,29,30)
InChIKeyBQXYAHWVQOZPTF-UHFFFAOYSA-N
MW412.66 g/mol
LogP8.89
Rot. Bonds20

About octacosa-10,13,16,19,22,25-hexaenoic acid

octacosa-10,13,16,19,22,25-hexaenoic acid (PubChem CID 75955160) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is octacosa-10,13,16,19,22,25-hexaenoic acid.

Molecular Properties

Compound Nameoctacosa-10,13,16,19,22,25-hexaenoic acid
PubChem CID75955160
Molecular FormulaC28H44O2
Molecular Weight412.66 g/mol
Exact Mass412.33
IUPAC Nameoctacosa-10,13,16,19,22,25-hexaenoic acid
SMILESCCC=CCC=CCC=CCC=CCC=CCC=CCCCCCCCCC(=O)O
InChIInChI=1S/C28H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28(29)30/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-27H2,1H3,(H,29,30)
InChIKeyBQXYAHWVQOZPTF-UHFFFAOYSA-N
XLogP8.89
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds20
Heavy Atoms30
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500412.66
LogP ≤ 58.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze octacosa-10,13,16,19,22,25-hexaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of octacosa-10,13,16,19,22,25-hexaenoic acid?
The IUPAC name of octacosa-10,13,16,19,22,25-hexaenoic acid (CID 75955160) is octacosa-10,13,16,19,22,25-hexaenoic acid.
What is the SMILES notation for octacosa-10,13,16,19,22,25-hexaenoic acid?
The canonical SMILES for octacosa-10,13,16,19,22,25-hexaenoic acid is CCC=CCC=CCC=CCC=CCC=CCC=CCCCCCCCCC(=O)O.
What is the InChIKey of octacosa-10,13,16,19,22,25-hexaenoic acid?
The InChIKey is BQXYAHWVQOZPTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28(29)30/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-27H2,1H3,(H,29,30).
What are the key properties of octacosa-10,13,16,19,22,25-hexaenoic acid?
octacosa-10,13,16,19,22,25-hexaenoic acid has a molecular weight of 412.66 g/mol, XLogP of 8.89, 20 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octacosa-10,13,16,19,22,25-hexaenoic acid is sourced from PubChem (CID 75955160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).