(9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid

C20H34O2 — CID 22321183

IUPAC(9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid
SMILESCC/C=C/C/C=C/C/C=C/CCCCCCC(CC)C(=O)O
InChIInChI=1S/C20H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(4-2)20(21)22/h5-6,8-9,11-12,19H,3-4,7,10,13-18H2,1-2H3,(H,21,22)/b6-5+,9-8+,12-11+
InChIKeyMNVDOLYULIAMDA-XSHSMGBESA-N
MW306.49 g/mol
LogP6.30
Rot. Bonds14

About (9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid

(9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid (PubChem CID 22321183) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid.

Molecular Properties

Compound Name(9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid
PubChem CID22321183
Molecular FormulaC20H34O2
Molecular Weight306.49 g/mol
Exact Mass306.26
IUPAC Name(9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid
SMILESCC/C=C/C/C=C/C/C=C/CCCCCCC(CC)C(=O)O
InChIInChI=1S/C20H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(4-2)20(21)22/h5-6,8-9,11-12,19H,3-4,7,10,13-18H2,1-2H3,(H,21,22)/b6-5+,9-8+,12-11+
InChIKeyMNVDOLYULIAMDA-XSHSMGBESA-N
XLogP6.30
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds14
Heavy Atoms22
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500306.49
LogP ≤ 56.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid?
The IUPAC name of (9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid (CID 22321183) is (9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid.
What is the SMILES notation for (9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid?
The canonical SMILES for (9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid is CC/C=C/C/C=C/C/C=C/CCCCCCC(CC)C(=O)O.
What is the InChIKey of (9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid?
The InChIKey is MNVDOLYULIAMDA-XSHSMGBESA-N. The full InChI is InChI=1S/C20H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(4-2)20(21)22/h5-6,8-9,11-12,19H,3-4,7,10,13-18H2,1-2H3,(H,21,22)/b6-5+,9-8+,12-11+.
What are the key properties of (9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid?
(9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid has a molecular weight of 306.49 g/mol, XLogP of 6.30, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (9E,12E,15E)-2-ethyloctadeca-9,12,15-trienoic acid is sourced from PubChem (CID 22321183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).