C22H38O2 — CID 59187765
ethyl (9Z,12Z,15Z)-2-ethyloctadeca-9,12,15-trienoate (PubChem CID 59187765) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is ethyl (9Z,12Z,15Z)-2-ethyloctadeca-9,12,15-trienoate.
| Compound Name | ethyl (9Z,12Z,15Z)-2-ethyloctadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 59187765 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | ethyl (9Z,12Z,15Z)-2-ethyloctadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(CC)C(=O)OCC |
| InChI | InChI=1S/C22H38O2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(5-2)22(23)24-6-3/h7-8,10-11,13-14,21H,4-6,9,12,15-20H2,1-3H3/b8-7-,11-10-,14-13- |
| InChIKey | WCZULAQWPRAZAV-JPFHKJGASA-N |
| XLogP | 6.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|