C26H40O2S — CID 91190100
ethyl 2-(2-sulfanylideneethyl)docosa-7,10,13,16,19-pentaenoate (PubChem CID 91190100) has the molecular formula C26H40O2S and a molecular weight of 416.67 g/mol. Its IUPAC name is ethyl 2-(2-sulfanylideneethyl)docosa-7,10,13,16,19-pentaenoate.
| Compound Name | ethyl 2-(2-sulfanylideneethyl)docosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 91190100 |
| Molecular Formula | C26H40O2S |
| Molecular Weight | 416.67 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | ethyl 2-(2-sulfanylideneethyl)docosa-7,10,13,16,19-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCC(CC=S)C(=O)OCC |
| InChI | InChI=1S/C26H40O2S/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25(23-24-29)26(27)28-4-2/h5-6,8-9,11-12,14-15,17-18,24-25H,3-4,7,10,13,16,19-23H2,1-2H3 |
| InChIKey | XFIHTBWOYZNAPP-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.67 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|