C24H42O3 — CID 59187783
ethyl (11Z,14Z,17Z)-2-ethoxyicosa-11,14,17-trienoate (PubChem CID 59187783) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is ethyl (11Z,14Z,17Z)-2-ethoxyicosa-11,14,17-trienoate.
| Compound Name | ethyl (11Z,14Z,17Z)-2-ethoxyicosa-11,14,17-trienoate |
|---|---|
| PubChem CID | 59187783 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | ethyl (11Z,14Z,17Z)-2-ethoxyicosa-11,14,17-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCC(OCC)C(=O)OCC |
| InChI | InChI=1S/C24H42O3/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(26-5-2)24(25)27-6-3/h7-8,10-11,13-14,23H,4-6,9,12,15-22H2,1-3H3/b8-7-,11-10-,14-13- |
| InChIKey | NKDDPGSUSZKHSD-JPFHKJGASA-N |
| XLogP | 6.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|