C24H36O3 — CID 71098212
ethyl (7Z,10Z)-11-[1-[(Z)-but-1-enyl]cyclohexa-2,5-dien-1-yl]-2-methoxyundeca-7,10-dienoate (PubChem CID 71098212) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is ethyl (7Z,10Z)-11-[1-[(Z)-but-1-enyl]cyclohexa-2,5-dien-1-yl]-2-methoxyundeca-7,10-dienoate.
| Compound Name | ethyl (7Z,10Z)-11-[1-[(Z)-but-1-enyl]cyclohexa-2,5-dien-1-yl]-2-methoxyundeca-7,10-dienoate |
|---|---|
| PubChem CID | 71098212 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | ethyl (7Z,10Z)-11-[1-[(Z)-but-1-enyl]cyclohexa-2,5-dien-1-yl]-2-methoxyundeca-7,10-dienoate |
| SMILES | CC/C=C\C1(/C=C\C/C=C\CCCCC(OC)C(=O)OCC)C=CCC=C1 |
| InChI | InChI=1S/C24H36O3/c1-4-6-18-24(20-15-12-16-21-24)19-14-11-9-7-8-10-13-17-22(26-3)23(25)27-5-2/h6-7,9,14-16,18-22H,4-5,8,10-13,17H2,1-3H3/b9-7-,18-6-,19-14- |
| InChIKey | TZODMBLXPGHXPS-KLRQMZCJSA-N |
| XLogP | 6.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|