C21H30O — CID 71098290
(Z)-5-[(5Z,8Z,11Z)-1-[(Z)-but-1-enyl]cyclododeca-2,5,8,11-tetraen-1-yl]pent-4-en-1-ol (PubChem CID 71098290) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is (Z)-5-[(5Z,8Z,11Z)-1-[(Z)-but-1-enyl]cyclododeca-2,5,8,11-tetraen-1-yl]pent-4-en-1-ol.
| Compound Name | (Z)-5-[(5Z,8Z,11Z)-1-[(Z)-but-1-enyl]cyclododeca-2,5,8,11-tetraen-1-yl]pent-4-en-1-ol |
|---|---|
| PubChem CID | 71098290 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (Z)-5-[(5Z,8Z,11Z)-1-[(Z)-but-1-enyl]cyclododeca-2,5,8,11-tetraen-1-yl]pent-4-en-1-ol |
| SMILES | CC/C=C\C1(/C=C\CCCO)C=CC/C=C\C/C=C\C/C=C\1 |
| InChI | InChI=1S/C21H30O/c1-2-3-16-21(19-14-11-15-20-22)17-12-9-7-5-4-6-8-10-13-18-21/h3,5-8,12-14,16-19,22H,2,4,9-11,15,20H2,1H3/b7-5-,8-6-,16-3-,17-12-,18-13?,19-14- |
| InChIKey | BTEOBUVCQJVGBF-AKTPCYSRSA-N |
| XLogP | 5.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|