C26H42O2 — CID 72538130
ethyl 2-ethyldocosa-7,10,13,16,19-pentaenoate (PubChem CID 72538130) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is ethyl 2-ethyldocosa-7,10,13,16,19-pentaenoate.
| Compound Name | ethyl 2-ethyldocosa-7,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 72538130 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | ethyl 2-ethyldocosa-7,10,13,16,19-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCC(CC)C(=O)OCC |
| InChI | InChI=1S/C26H42O2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(5-2)26(27)28-6-3/h7-8,10-11,13-14,16-17,19-20,25H,4-6,9,12,15,18,21-24H2,1-3H3 |
| InChIKey | ITBGINOVRGBCOP-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|