C23H30O3 — CID 70918892
ethyl (4E,7Z)-2-methoxy-8-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)octa-4,7-dienoate (PubChem CID 70918892) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is ethyl (4E,7Z)-2-methoxy-8-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)octa-4,7-dienoate.
| Compound Name | ethyl (4E,7Z)-2-methoxy-8-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)octa-4,7-dienoate |
|---|---|
| PubChem CID | 70918892 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | ethyl (4E,7Z)-2-methoxy-8-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)octa-4,7-dienoate |
| SMILES | CCOC(=O)C(C/C=C/C/C=C\C1(C)C=CC2(C=CCC=C2)C=C1)OC |
| InChI | InChI=1S/C23H30O3/c1-4-26-21(24)20(25-3)12-8-5-6-9-13-22(2)16-18-23(19-17-22)14-10-7-11-15-23/h5,8-11,13-20H,4,6-7,12H2,1-3H3/b8-5+,13-9- |
| InChIKey | UMVYQFWBCRJDTJ-GKPGWJKISA-N |
| XLogP | 5.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|