C25H34O3 — CID 70918886
ethyl (4E,7Z)-8-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)-2-propoxyocta-4,7-dienoate (PubChem CID 70918886) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is ethyl (4E,7Z)-8-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)-2-propoxyocta-4,7-dienoate.
| Compound Name | ethyl (4E,7Z)-8-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)-2-propoxyocta-4,7-dienoate |
|---|---|
| PubChem CID | 70918886 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | ethyl (4E,7Z)-8-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)-2-propoxyocta-4,7-dienoate |
| SMILES | CCCOC(C/C=C/C/C=C\C1(C)C=CC2(C=CCC=C2)C=C1)C(=O)OCC |
| InChI | InChI=1S/C25H34O3/c1-4-21-28-22(23(26)27-5-2)13-9-6-7-10-14-24(3)17-19-25(20-18-24)15-11-8-12-16-25/h6,9-12,14-20,22H,4-5,7-8,13,21H2,1-3H3/b9-6+,14-10- |
| InChIKey | WGYXDGNJRWSOPP-NHZNEZGNSA-N |
| XLogP | 5.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|