C25H38O2S — CID 59187756
ethyl (4E,7Z,10Z,13Z,16Z,19Z)-2-methylsulfanyldocosa-4,7,10,13,16,19-hexaenoate (PubChem CID 59187756) has the molecular formula C25H38O2S and a molecular weight of 402.64 g/mol. Its IUPAC name is ethyl (4E,7Z,10Z,13Z,16Z,19Z)-2-methylsulfanyldocosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | ethyl (4E,7Z,10Z,13Z,16Z,19Z)-2-methylsulfanyldocosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 59187756 |
| Molecular Formula | C25H38O2S |
| Molecular Weight | 402.64 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | ethyl (4E,7Z,10Z,13Z,16Z,19Z)-2-methylsulfanyldocosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C/CC(SC)C(=O)OCC |
| InChI | InChI=1S/C25H38O2S/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(28-3)25(26)27-5-2/h6-7,9-10,12-13,15-16,18-19,21-22,24H,4-5,8,11,14,17,20,23H2,1-3H3/b7-6-,10-9-,13-12-,16-15-,19-18-,22-21+ |
| InChIKey | KCYMLTHEWORGSS-PIHPVOMWSA-N |
| XLogP | 7.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.64 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|