C23H36O2S — CID 72538142
ethyl 2-methylsulfanylicosa-5,8,11,14,17-pentaenoate (PubChem CID 72538142) has the molecular formula C23H36O2S and a molecular weight of 376.61 g/mol. Its IUPAC name is ethyl 2-methylsulfanylicosa-5,8,11,14,17-pentaenoate.
| Compound Name | ethyl 2-methylsulfanylicosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 72538142 |
| Molecular Formula | C23H36O2S |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | ethyl 2-methylsulfanylicosa-5,8,11,14,17-pentaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCC(SC)C(=O)OCC |
| InChI | InChI=1S/C23H36O2S/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(26-3)23(24)25-5-2/h6-7,9-10,12-13,15-16,18-19,22H,4-5,8,11,14,17,20-21H2,1-3H3 |
| InChIKey | LXTSABLDXUAEHW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|