C25H40O2 — CID 59187782
ethyl (4E,8Z,11Z,14Z,17Z)-2-propylicosa-4,8,11,14,17-pentaenoate (PubChem CID 59187782) has the molecular formula C25H40O2 and a molecular weight of 372.59 g/mol. Its IUPAC name is ethyl (4E,8Z,11Z,14Z,17Z)-2-propylicosa-4,8,11,14,17-pentaenoate.
| Compound Name | ethyl (4E,8Z,11Z,14Z,17Z)-2-propylicosa-4,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 59187782 |
| Molecular Formula | C25H40O2 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | ethyl (4E,8Z,11Z,14Z,17Z)-2-propylicosa-4,8,11,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CC/C=C/CC(CCC)C(=O)OCC |
| InChI | InChI=1S/C25H40O2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-24(22-5-2)25(26)27-6-3/h7-8,10-11,13-14,16-17,20-21,24H,4-6,9,12,15,18-19,22-23H2,1-3H3/b8-7-,11-10-,14-13-,17-16-,21-20+ |
| InChIKey | ZWUBOJOAPQEJLD-FZDJQYMKSA-N |
| XLogP | 7.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|