C28H44O4 — CID 87473933
1,3-dihydroxypropan-2-yl (4E,7E,10E,13E,16E,19E)-2-propyldocosa-4,7,10,13,16,19-hexaenoate (PubChem CID 87473933) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (4E,7E,10E,13E,16E,19E)-2-propyldocosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | 1,3-dihydroxypropan-2-yl (4E,7E,10E,13E,16E,19E)-2-propyldocosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 87473933 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (4E,7E,10E,13E,16E,19E)-2-propyldocosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CC(CCC)C(=O)OC(CO)CO |
| InChI | InChI=1S/C28H44O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-26(22-4-2)28(31)32-27(24-29)25-30/h5-6,8-9,11-12,14-15,17-18,20-21,26-27,29-30H,3-4,7,10,13,16,19,22-25H2,1-2H3/b6-5+,9-8+,12-11+,15-14+,18-17+,21-20+ |
| InChIKey | FEKINCXYQQOFPF-YATCGRJWSA-N |
| XLogP | 6.39 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|