C35H52N2O8 — CID 123298917
4-[[3-(1,3-dihydroxypropan-2-yloxycarbonyl)-5-(docosa-4,7,10,13,16,19-hexaenoylamino)pentyl]amino]-4-oxobut-2-enoic acid (PubChem CID 123298917) has the molecular formula C35H52N2O8 and a molecular weight of 628.81 g/mol. Its IUPAC name is 4-[[3-(1,3-dihydroxypropan-2-yloxycarbonyl)-5-(docosa-4,7,10,13,16,19-hexaenoylamino)pentyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[3-(1,3-dihydroxypropan-2-yloxycarbonyl)-5-(docosa-4,7,10,13,16,19-hexaenoylamino)pentyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 123298917 |
| Molecular Formula | C35H52N2O8 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | 4-[[3-(1,3-dihydroxypropan-2-yloxycarbonyl)-5-(docosa-4,7,10,13,16,19-hexaenoylamino)pentyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCC(CCNC(=O)C=CC(=O)O)C(=O)OC(CO)CO |
| InChI | InChI=1S/C35H52N2O8/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-32(40)36-26-24-30(35(44)45-31(28-38)29-39)25-27-37-33(41)22-23-34(42)43/h3-4,6-7,9-10,12-13,15-16,18-19,22-23,30-31,38-39H,2,5,8,11,14,17,20-21,24-29H2,1H3,(H,36,40)(H,37,41)(H,42,43) |
| InChIKey | WXTRHAAVUYMIOT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 162.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|