C36H54N2O8 — CID 87351477
1,3-dihydroxypropan-2-yl 6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]hexanoate (PubChem CID 87351477) has the molecular formula C36H54N2O8 and a molecular weight of 642.83 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]hexanoate.
| Compound Name | 1,3-dihydroxypropan-2-yl 6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]hexanoate |
|---|---|
| PubChem CID | 87351477 |
| Molecular Formula | C36H54N2O8 |
| Molecular Weight | 642.83 g/mol |
| Exact Mass | 642.39 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]hexanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCCCC(NC(=O)/C=C/C(=O)OC)C(=O)OC(CO)CO |
| InChI | InChI=1S/C36H54N2O8/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-33(41)37-28-23-22-24-32(36(44)46-31(29-39)30-40)38-34(42)26-27-35(43)45-2/h4-5,7-8,10-11,13-14,16-17,19-20,26-27,31-32,39-40H,3,6,9,12,15,18,21-25,28-30H2,1-2H3,(H,37,41)(H,38,42)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-,27-26+ |
| InChIKey | QVUDOFMFOSGTJY-NJSZJYBASA-N |
| XLogP | 4.86 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.83 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|