C33H48N2O6 — CID 123461309
(2S)-2-(docosa-4,7,10,13,16,19-hexaenoylamino)-6-[(4-methoxy-4-oxobut-2-enoyl)amino]hexanoic acid (PubChem CID 123461309) has the molecular formula C33H48N2O6 and a molecular weight of 568.76 g/mol. Its IUPAC name is (2S)-2-(docosa-4,7,10,13,16,19-hexaenoylamino)-6-[(4-methoxy-4-oxobut-2-enoyl)amino]hexanoic acid.
| Compound Name | (2S)-2-(docosa-4,7,10,13,16,19-hexaenoylamino)-6-[(4-methoxy-4-oxobut-2-enoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 123461309 |
| Molecular Formula | C33H48N2O6 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.35 |
| IUPAC Name | (2S)-2-(docosa-4,7,10,13,16,19-hexaenoylamino)-6-[(4-methoxy-4-oxobut-2-enoyl)amino]hexanoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)N[C@@H](CCCCNC(=O)C=CC(=O)OC)C(=O)O |
| InChI | InChI=1S/C33H48N2O6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-31(37)35-29(33(39)40)24-22-23-28-34-30(36)26-27-32(38)41-2/h4-5,7-8,10-11,13-14,16-17,19-20,26-27,29H,3,6,9,12,15,18,21-25,28H2,1-2H3,(H,34,36)(H,35,37)(H,39,40)/t29-/m0/s1 |
| InChIKey | IKGHIHWQMNTFGI-LJAQVGFWSA-N |
| XLogP | 6.05 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|