C35H48N2O7 — CID 71617928
2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-6-[(3,4,5-trihydroxybenzoyl)amino]hexanoic acid (PubChem CID 71617928) has the molecular formula C35H48N2O7 and a molecular weight of 608.78 g/mol. Its IUPAC name is 2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-6-[(3,4,5-trihydroxybenzoyl)amino]hexanoic acid.
| Compound Name | 2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-6-[(3,4,5-trihydroxybenzoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 71617928 |
| Molecular Formula | C35H48N2O7 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.35 |
| IUPAC Name | 2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-6-[(3,4,5-trihydroxybenzoyl)amino]hexanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NC(CCCCNC(=O)c1cc(O)c(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C35H48N2O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-32(40)37-29(35(43)44)23-21-22-25-36-34(42)28-26-30(38)33(41)31(39)27-28/h3-4,6-7,9-10,12-13,15-16,18-19,26-27,29,38-39,41H,2,5,8,11,14,17,20-25H2,1H3,(H,36,42)(H,37,40)(H,43,44)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | PXYPLWCCFFDNGF-KUBAVDMBSA-N |
| XLogP | 6.75 |
| TPSA | 156.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|