C35H50N2O4 — CID 123765118
2-benzamido-6-(docosa-4,7,10,13,16-pentaenoylamino)hexanoic acid (PubChem CID 123765118) has the molecular formula C35H50N2O4 and a molecular weight of 562.80 g/mol. Its IUPAC name is 2-benzamido-6-(docosa-4,7,10,13,16-pentaenoylamino)hexanoic acid.
| Compound Name | 2-benzamido-6-(docosa-4,7,10,13,16-pentaenoylamino)hexanoic acid |
|---|---|
| PubChem CID | 123765118 |
| Molecular Formula | C35H50N2O4 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.38 |
| IUPAC Name | 2-benzamido-6-(docosa-4,7,10,13,16-pentaenoylamino)hexanoic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCCCC(NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C35H50N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-29-33(38)36-30-25-24-28-32(35(40)41)37-34(39)31-26-21-20-22-27-31/h6-7,9-10,12-13,15-16,18-22,26-27,32H,2-5,8,11,14,17,23-25,28-30H2,1H3,(H,36,38)(H,37,39)(H,40,41) |
| InChIKey | UZZGWXMJOOCXKF-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|