C29H48N4O4 — CID 177405208
(2R)-2-[[(2R)-2-benzamido-3-methylbutanoyl]amino]-N,N'-dihexylpentanediamide (PubChem CID 177405208) has the molecular formula C29H48N4O4 and a molecular weight of 516.73 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-benzamido-3-methylbutanoyl]amino]-N,N'-dihexylpentanediamide.
| Compound Name | (2R)-2-[[(2R)-2-benzamido-3-methylbutanoyl]amino]-N,N'-dihexylpentanediamide |
|---|---|
| PubChem CID | 177405208 |
| Molecular Formula | C29H48N4O4 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.37 |
| IUPAC Name | (2R)-2-[[(2R)-2-benzamido-3-methylbutanoyl]amino]-N,N'-dihexylpentanediamide |
| SMILES | CCCCCCNC(=O)CC[C@@H](NC(=O)[C@H](NC(=O)c1ccccc1)C(C)C)C(=O)NCCCCCC |
| InChI | InChI=1S/C29H48N4O4/c1-5-7-9-14-20-30-25(34)19-18-24(28(36)31-21-15-10-8-6-2)32-29(37)26(22(3)4)33-27(35)23-16-12-11-13-17-23/h11-13,16-17,22,24,26H,5-10,14-15,18-21H2,1-4H3,(H,30,34)(H,31,36)(H,32,37)(H,33,35)/t24-,26-/m1/s1 |
| InChIKey | ZIAVXCRVWHDKOU-AOYPEHQESA-N |
| XLogP | 4.10 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|