C21H41N3O3 — CID 71362769
(2S)-N,N'-dibutyl-2-(octanoylamino)pentanediamide (PubChem CID 71362769) has the molecular formula C21H41N3O3 and a molecular weight of 383.58 g/mol. Its IUPAC name is (2S)-N,N'-dibutyl-2-(octanoylamino)pentanediamide.
| Compound Name | (2S)-N,N'-dibutyl-2-(octanoylamino)pentanediamide |
|---|---|
| PubChem CID | 71362769 |
| Molecular Formula | C21H41N3O3 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.31 |
| IUPAC Name | (2S)-N,N'-dibutyl-2-(octanoylamino)pentanediamide |
| SMILES | CCCCCCCC(=O)N[C@@H](CCC(=O)NCCCC)C(=O)NCCCC |
| InChI | InChI=1S/C21H41N3O3/c1-4-7-10-11-12-13-20(26)24-18(21(27)23-17-9-6-3)14-15-19(25)22-16-8-5-2/h18H,4-17H2,1-3H3,(H,22,25)(H,23,27)(H,24,26)/t18-/m0/s1 |
| InChIKey | ROVCBBIYGALCJO-SFHVURJKSA-N |
| XLogP | 3.44 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|