C28H54N4O4 — CID 129160890
N-[6-[2-(butanoylamino)ethylamino]-5-(octanoylamino)-6-oxohexyl]octanamide (PubChem CID 129160890) has the molecular formula C28H54N4O4 and a molecular weight of 510.76 g/mol. Its IUPAC name is N-[6-[2-(butanoylamino)ethylamino]-5-(octanoylamino)-6-oxohexyl]octanamide.
| Compound Name | N-[6-[2-(butanoylamino)ethylamino]-5-(octanoylamino)-6-oxohexyl]octanamide |
|---|---|
| PubChem CID | 129160890 |
| Molecular Formula | C28H54N4O4 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.41 |
| IUPAC Name | N-[6-[2-(butanoylamino)ethylamino]-5-(octanoylamino)-6-oxohexyl]octanamide |
| SMILES | CCCCCCCC(=O)NCCCCC(NC(=O)CCCCCCC)C(=O)NCCNC(=O)CCC |
| InChI | InChI=1S/C28H54N4O4/c1-4-7-9-11-13-19-26(34)29-21-16-15-18-24(32-27(35)20-14-12-10-8-5-2)28(36)31-23-22-30-25(33)17-6-3/h24H,4-23H2,1-3H3,(H,29,34)(H,30,33)(H,31,36)(H,32,35) |
| InChIKey | XULCONLLGILJOG-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|