C31H60N4O4 — CID 118183467
2,6-bis(hexanoylamino)-N-[7-(hexylamino)-2-oxoheptan-3-yl]hexanamide (PubChem CID 118183467) has the molecular formula C31H60N4O4 and a molecular weight of 552.85 g/mol. Its IUPAC name is 2,6-bis(hexanoylamino)-N-[7-(hexylamino)-2-oxoheptan-3-yl]hexanamide.
| Compound Name | 2,6-bis(hexanoylamino)-N-[7-(hexylamino)-2-oxoheptan-3-yl]hexanamide |
|---|---|
| PubChem CID | 118183467 |
| Molecular Formula | C31H60N4O4 |
| Molecular Weight | 552.85 g/mol |
| Exact Mass | 552.46 |
| IUPAC Name | 2,6-bis(hexanoylamino)-N-[7-(hexylamino)-2-oxoheptan-3-yl]hexanamide |
| SMILES | CCCCCCNCCCCC(NC(=O)C(CCCCNC(=O)CCCCC)NC(=O)CCCCC)C(C)=O |
| InChI | InChI=1S/C31H60N4O4/c1-5-8-11-16-23-32-24-17-14-19-27(26(4)36)35-31(39)28(34-30(38)22-13-10-7-3)20-15-18-25-33-29(37)21-12-9-6-2/h27-28,32H,5-25H2,1-4H3,(H,33,37)(H,34,38)(H,35,39) |
| InChIKey | RAHQQJLRTKIRLP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.85 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|