C28H54N6O5 — CID 144955525
2-[[6-(5-aminopentanoylamino)-2-(hexanoylamino)hexanoyl]amino]-6-(pentanoylamino)hexanamide (PubChem CID 144955525) has the molecular formula C28H54N6O5 and a molecular weight of 554.78 g/mol. Its IUPAC name is 2-[[6-(5-aminopentanoylamino)-2-(hexanoylamino)hexanoyl]amino]-6-(pentanoylamino)hexanamide.
| Compound Name | 2-[[6-(5-aminopentanoylamino)-2-(hexanoylamino)hexanoyl]amino]-6-(pentanoylamino)hexanamide |
|---|---|
| PubChem CID | 144955525 |
| Molecular Formula | C28H54N6O5 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.42 |
| IUPAC Name | 2-[[6-(5-aminopentanoylamino)-2-(hexanoylamino)hexanoyl]amino]-6-(pentanoylamino)hexanamide |
| SMILES | CCCCCC(=O)NC(CCCCNC(=O)CCCCN)C(=O)NC(CCCCNC(=O)CCCC)C(N)=O |
| InChI | InChI=1S/C28H54N6O5/c1-3-5-7-18-26(37)33-23(15-10-13-21-32-25(36)17-8-11-19-29)28(39)34-22(27(30)38)14-9-12-20-31-24(35)16-6-4-2/h22-23H,3-21,29H2,1-2H3,(H2,30,38)(H,31,35)(H,32,36)(H,33,37)(H,34,39) |
| InChIKey | YJTMTJWHCALYKS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|