C24H47N5O4 — CID 144955370
N-(7-amino-2-oxoheptan-3-yl)-6-(5-aminopentanoylamino)-2-(hexanoylamino)hexanamide (PubChem CID 144955370) has the molecular formula C24H47N5O4 and a molecular weight of 469.67 g/mol. Its IUPAC name is N-(7-amino-2-oxoheptan-3-yl)-6-(5-aminopentanoylamino)-2-(hexanoylamino)hexanamide.
| Compound Name | N-(7-amino-2-oxoheptan-3-yl)-6-(5-aminopentanoylamino)-2-(hexanoylamino)hexanamide |
|---|---|
| PubChem CID | 144955370 |
| Molecular Formula | C24H47N5O4 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.36 |
| IUPAC Name | N-(7-amino-2-oxoheptan-3-yl)-6-(5-aminopentanoylamino)-2-(hexanoylamino)hexanamide |
| SMILES | CCCCCC(=O)NC(CCCCNC(=O)CCCCN)C(=O)NC(CCCCN)C(C)=O |
| InChI | InChI=1S/C24H47N5O4/c1-3-4-5-15-23(32)28-21(13-8-11-18-27-22(31)14-7-10-17-26)24(33)29-20(19(2)30)12-6-9-16-25/h20-21H,3-18,25-26H2,1-2H3,(H,27,31)(H,28,32)(H,29,33) |
| InChIKey | FNQLLNRMCJQFSY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|