C24H44I4N4O4-2 — CID 148669249
2,6-bis(hexanoylamino)-N-[1-iodoiodanuidyl-6-(iodoiodanuidylamino)-1-oxohexan-2-yl]hexanamide (PubChem CID 148669249) has the molecular formula C24H44I4N4O4-2 and a molecular weight of 960.26 g/mol. Its IUPAC name is 2,6-bis(hexanoylamino)-N-[1-iodoiodanuidyl-6-(iodoiodanuidylamino)-1-oxohexan-2-yl]hexanamide.
| Compound Name | 2,6-bis(hexanoylamino)-N-[1-iodoiodanuidyl-6-(iodoiodanuidylamino)-1-oxohexan-2-yl]hexanamide |
|---|---|
| PubChem CID | 148669249 |
| Molecular Formula | C24H44I4N4O4-2 |
| Molecular Weight | 960.26 g/mol |
| Exact Mass | 959.96 |
| IUPAC Name | 2,6-bis(hexanoylamino)-N-[1-iodoiodanuidyl-6-(iodoiodanuidylamino)-1-oxohexan-2-yl]hexanamide |
| SMILES | CCCCCC(=O)NCCCCC(NC(=O)CCCCC)C(=O)NC(CCCCN[I-]I)C(=O)[I-]I |
| InChI | InChI=1S/C24H44I4N4O4/c1-3-5-7-15-21(33)29-17-11-9-14-20(31-22(34)16-8-6-4-2)24(36)32-19(23(35)27-25)13-10-12-18-30-28-26/h19-20,30H,3-18H2,1-2H3,(H,29,33)(H,31,34)(H,32,36)/q-2 |
| InChIKey | SFHJIKLUAJBHNC-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.26 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|