C25H28N2O5 — CID 68703753
(4S)-5-(hexylamino)-5-oxo-4-[(9-oxofluorene-2-carbonyl)amino]pentanoic acid (PubChem CID 68703753) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is (4S)-5-(hexylamino)-5-oxo-4-[(9-oxofluorene-2-carbonyl)amino]pentanoic acid.
| Compound Name | (4S)-5-(hexylamino)-5-oxo-4-[(9-oxofluorene-2-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 68703753 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | (4S)-5-(hexylamino)-5-oxo-4-[(9-oxofluorene-2-carbonyl)amino]pentanoic acid |
| SMILES | CCCCCCNC(=O)[C@H](CCC(=O)O)NC(=O)c1ccc2c(c1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C25H28N2O5/c1-2-3-4-7-14-26-25(32)21(12-13-22(28)29)27-24(31)16-10-11-18-17-8-5-6-9-19(17)23(30)20(18)15-16/h5-6,8-11,15,21H,2-4,7,12-14H2,1H3,(H,26,32)(H,27,31)(H,28,29)/t21-/m0/s1 |
| InChIKey | KBQCHFWWWOAUKP-NRFANRHFSA-N |
| XLogP | 3.56 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|