C23H28N2O5 — CID 67334230
(4S)-5-(5-hydroxypentylamino)-5-oxo-4-[(4-phenylbenzoyl)amino]pentanoic acid (PubChem CID 67334230) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is (4S)-5-(5-hydroxypentylamino)-5-oxo-4-[(4-phenylbenzoyl)amino]pentanoic acid.
| Compound Name | (4S)-5-(5-hydroxypentylamino)-5-oxo-4-[(4-phenylbenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 67334230 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | (4S)-5-(5-hydroxypentylamino)-5-oxo-4-[(4-phenylbenzoyl)amino]pentanoic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1ccc(-c2ccccc2)cc1)C(=O)NCCCCCO |
| InChI | InChI=1S/C23H28N2O5/c26-16-6-2-5-15-24-23(30)20(13-14-21(27)28)25-22(29)19-11-9-18(10-12-19)17-7-3-1-4-8-17/h1,3-4,7-12,20,26H,2,5-6,13-16H2,(H,24,30)(H,25,29)(H,27,28)/t20-/m0/s1 |
| InChIKey | AKEUOYUVUKLLAA-FQEVSTJZSA-N |
| XLogP | 2.60 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|