C33H42IN5O10 — CID 165002399
(2S)-2-[[(1S)-1-carboxybutyl]carbamoylamino]-6-[[(2S)-2-[[(2S)-4-carboxy-2-[(4-iodobenzoyl)amino]butanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 165002399) has the molecular formula C33H42IN5O10 and a molecular weight of 795.63 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxybutyl]carbamoylamino]-6-[[(2S)-2-[[(2S)-4-carboxy-2-[(4-iodobenzoyl)amino]butanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[(1S)-1-carboxybutyl]carbamoylamino]-6-[[(2S)-2-[[(2S)-4-carboxy-2-[(4-iodobenzoyl)amino]butanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 165002399 |
| Molecular Formula | C33H42IN5O10 |
| Molecular Weight | 795.63 g/mol |
| Exact Mass | 795.20 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxybutyl]carbamoylamino]-6-[[(2S)-2-[[(2S)-4-carboxy-2-[(4-iodobenzoyl)amino]butanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | CCC[C@H](NC(=O)N[C@@H](CCCCNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)c1ccc(I)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C33H42IN5O10/c1-2-8-24(31(45)46)38-33(49)39-25(32(47)48)11-6-7-18-35-29(43)26(19-20-9-4-3-5-10-20)37-30(44)23(16-17-27(40)41)36-28(42)21-12-14-22(34)15-13-21/h3-5,9-10,12-15,23-26H,2,6-8,11,16-19H2,1H3,(H,35,43)(H,36,42)(H,37,44)(H,40,41)(H,45,46)(H,47,48)(H2,38,39,49)/t23-,24-,25-,26-/m0/s1 |
| InChIKey | RAZDIJRPBFEHMQ-CQJMVLFOSA-N |
| XLogP | 2.27 |
| TPSA | 240.33 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.63 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|