C28H30N2O4 — CID 67332259
(4S)-5-oxo-4-[(4-phenylbenzoyl)amino]-5-(4-phenylbutylamino)pentanoic acid (PubChem CID 67332259) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is (4S)-5-oxo-4-[(4-phenylbenzoyl)amino]-5-(4-phenylbutylamino)pentanoic acid.
| Compound Name | (4S)-5-oxo-4-[(4-phenylbenzoyl)amino]-5-(4-phenylbutylamino)pentanoic acid |
|---|---|
| PubChem CID | 67332259 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (4S)-5-oxo-4-[(4-phenylbenzoyl)amino]-5-(4-phenylbutylamino)pentanoic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1ccc(-c2ccccc2)cc1)C(=O)NCCCCc1ccccc1 |
| InChI | InChI=1S/C28H30N2O4/c31-26(32)19-18-25(28(34)29-20-8-7-11-21-9-3-1-4-10-21)30-27(33)24-16-14-23(15-17-24)22-12-5-2-6-13-22/h1-6,9-10,12-17,25H,7-8,11,18-20H2,(H,29,34)(H,30,33)(H,31,32)/t25-/m0/s1 |
| InChIKey | IPWOYKVDWILZCD-VWLOTQADSA-N |
| XLogP | 4.46 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|