C24H27N3O5 — CID 57314577
5-[4-(4-cyanophenyl)butylamino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 57314577) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is 5-[4-(4-cyanophenyl)butylamino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-[4-(4-cyanophenyl)butylamino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 57314577 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 5-[4-(4-cyanophenyl)butylamino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | N#Cc1ccc(CCCCNC(=O)C(CCC(=O)O)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H27N3O5/c25-16-19-11-9-18(10-12-19)6-4-5-15-26-23(30)21(13-14-22(28)29)27-24(31)32-17-20-7-2-1-3-8-20/h1-3,7-12,21H,4-6,13-15,17H2,(H,26,30)(H,27,31)(H,28,29) |
| InChIKey | DYJUWCDAURQQFM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|