C26H34N4O5 — CID 15391507
ethyl (4R)-5-[4-(4-carbamimidoylphenyl)butylamino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 15391507) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is ethyl (4R)-5-[4-(4-carbamimidoylphenyl)butylamino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | ethyl (4R)-5-[4-(4-carbamimidoylphenyl)butylamino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 15391507 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | ethyl (4R)-5-[4-(4-carbamimidoylphenyl)butylamino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | [H]/N=C(\N)c1ccc(CCCCNC(=O)[C@@H](CCC(=O)OCC)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H34N4O5/c1-2-34-23(31)16-15-22(30-26(33)35-18-20-9-4-3-5-10-20)25(32)29-17-7-6-8-19-11-13-21(14-12-19)24(27)28/h3-5,9-14,22H,2,6-8,15-18H2,1H3,(H3,27,28)(H,29,32)(H,30,33)/t22-/m1/s1 |
| InChIKey | DCJNEWNHPQRRRU-JOCHJYFZSA-N |
| XLogP | 3.05 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|