C16H23N3O3 — CID 22853901
(3R)-4-[4-(4-carbamimidoylphenyl)butylamino]-3-methyl-4-oxobutanoic acid (PubChem CID 22853901) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (3R)-4-[4-(4-carbamimidoylphenyl)butylamino]-3-methyl-4-oxobutanoic acid.
| Compound Name | (3R)-4-[4-(4-carbamimidoylphenyl)butylamino]-3-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22853901 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (3R)-4-[4-(4-carbamimidoylphenyl)butylamino]-3-methyl-4-oxobutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CCCCNC(=O)[C@H](C)CC(=O)O)cc1 |
| InChI | InChI=1S/C16H23N3O3/c1-11(10-14(20)21)16(22)19-9-3-2-4-12-5-7-13(8-6-12)15(17)18/h5-8,11H,2-4,9-10H2,1H3,(H3,17,18)(H,19,22)(H,20,21)/t11-/m1/s1 |
| InChIKey | VJPSORIBMUYISP-LLVKDONJSA-N |
| XLogP | 1.52 |
| TPSA | 116.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|