C27H38N4O2 — CID 159029340
(2R,5R)-N-[(4-carbamimidoylphenyl)methyl]-2-methyl-4-oxo-5-(pentylamino)-7-phenylheptanamide (PubChem CID 159029340) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is (2R,5R)-N-[(4-carbamimidoylphenyl)methyl]-2-methyl-4-oxo-5-(pentylamino)-7-phenylheptanamide.
| Compound Name | (2R,5R)-N-[(4-carbamimidoylphenyl)methyl]-2-methyl-4-oxo-5-(pentylamino)-7-phenylheptanamide |
|---|---|
| PubChem CID | 159029340 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (2R,5R)-N-[(4-carbamimidoylphenyl)methyl]-2-methyl-4-oxo-5-(pentylamino)-7-phenylheptanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)CC(=O)[C@@H](CCc2ccccc2)NCCCCC)cc1 |
| InChI | InChI=1S/C27H38N4O2/c1-3-4-8-17-30-24(16-13-21-9-6-5-7-10-21)25(32)18-20(2)27(33)31-19-22-11-14-23(15-12-22)26(28)29/h5-7,9-12,14-15,20,24,30H,3-4,8,13,16-19H2,1-2H3,(H3,28,29)(H,31,33)/t20-,24-/m1/s1 |
| InChIKey | JURINYZMUVNKMG-HYBUGGRVSA-N |
| XLogP | 3.96 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|