C27H33N5O2 — CID 148918051
(2R,5R)-N-[(4-carbamimidoylphenyl)methyl]-2-methyl-4-oxo-7-phenyl-5-(1H-pyrrol-2-ylmethylamino)heptanamide (PubChem CID 148918051) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is (2R,5R)-N-[(4-carbamimidoylphenyl)methyl]-2-methyl-4-oxo-7-phenyl-5-(1H-pyrrol-2-ylmethylamino)heptanamide.
| Compound Name | (2R,5R)-N-[(4-carbamimidoylphenyl)methyl]-2-methyl-4-oxo-7-phenyl-5-(1H-pyrrol-2-ylmethylamino)heptanamide |
|---|---|
| PubChem CID | 148918051 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | (2R,5R)-N-[(4-carbamimidoylphenyl)methyl]-2-methyl-4-oxo-7-phenyl-5-(1H-pyrrol-2-ylmethylamino)heptanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)CC(=O)[C@@H](CCc2ccccc2)NCc2ccc[nH]2)cc1 |
| InChI | InChI=1S/C27H33N5O2/c1-19(27(34)32-17-21-9-12-22(13-10-21)26(28)29)16-25(33)24(31-18-23-8-5-15-30-23)14-11-20-6-3-2-4-7-20/h2-10,12-13,15,19,24,30-31H,11,14,16-18H2,1H3,(H3,28,29)(H,32,34)/t19-,24-/m1/s1 |
| InChIKey | PJYUSMOPEYSJSW-NTKDMRAZSA-N |
| XLogP | 3.30 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|