C30H37N5O4 — CID 147649083
(2R)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-2-[[4-(2-hydroxyethoxy)phenyl]methylamino]-4-phenylbutanamide (PubChem CID 147649083) has the molecular formula C30H37N5O4 and a molecular weight of 531.66 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-2-[[4-(2-hydroxyethoxy)phenyl]methylamino]-4-phenylbutanamide.
| Compound Name | (2R)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-2-[[4-(2-hydroxyethoxy)phenyl]methylamino]-4-phenylbutanamide |
|---|---|
| PubChem CID | 147649083 |
| Molecular Formula | C30H37N5O4 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | (2R)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-2-[[4-(2-hydroxyethoxy)phenyl]methylamino]-4-phenylbutanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)NC(=O)[C@@H](CCc2ccccc2)NCc2ccc(OCCO)cc2)cc1 |
| InChI | InChI=1S/C30H37N5O4/c1-21(29(37)34-20-23-7-12-25(13-8-23)28(31)32)35-30(38)27(16-11-22-5-3-2-4-6-22)33-19-24-9-14-26(15-10-24)39-18-17-36/h2-10,12-15,21,27,33,36H,11,16-20H2,1H3,(H3,31,32)(H,34,37)(H,35,38)/t21-,27+/m0/s1 |
| InChIKey | GJDLFBQQMFIFKK-KDYSTLNUSA-N |
| XLogP | 2.25 |
| TPSA | 149.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|