C32H40N6O3 — CID 149023227
(2R)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-2-[(4-morpholin-4-ylphenyl)methylamino]-4-phenylbutanamide (PubChem CID 149023227) has the molecular formula C32H40N6O3 and a molecular weight of 556.71 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-2-[(4-morpholin-4-ylphenyl)methylamino]-4-phenylbutanamide.
| Compound Name | (2R)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-2-[(4-morpholin-4-ylphenyl)methylamino]-4-phenylbutanamide |
|---|---|
| PubChem CID | 149023227 |
| Molecular Formula | C32H40N6O3 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | (2R)-N-[(2S)-1-[(4-carbamimidoylphenyl)methylamino]-1-oxopropan-2-yl]-2-[(4-morpholin-4-ylphenyl)methylamino]-4-phenylbutanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)NC(=O)[C@@H](CCc2ccccc2)NCc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C32H40N6O3/c1-23(31(39)36-22-25-7-12-27(13-8-25)30(33)34)37-32(40)29(16-11-24-5-3-2-4-6-24)35-21-26-9-14-28(15-10-26)38-17-19-41-20-18-38/h2-10,12-15,23,29,35H,11,16-22H2,1H3,(H3,33,34)(H,36,39)(H,37,40)/t23-,29+/m0/s1 |
| InChIKey | QDWHWLJJDFWNPU-MUAVYFROSA-N |
| XLogP | 2.72 |
| TPSA | 132.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|