C24H32N6O3 — CID 156851548
N-[(4-carbamimidoylphenyl)methyl]-2-[[2-[(4-morpholin-4-ylphenyl)methylamino]acetyl]amino]propanamide (PubChem CID 156851548) has the molecular formula C24H32N6O3 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[(4-carbamimidoylphenyl)methyl]-2-[[2-[(4-morpholin-4-ylphenyl)methylamino]acetyl]amino]propanamide.
| Compound Name | N-[(4-carbamimidoylphenyl)methyl]-2-[[2-[(4-morpholin-4-ylphenyl)methylamino]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 156851548 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | N-[(4-carbamimidoylphenyl)methyl]-2-[[2-[(4-morpholin-4-ylphenyl)methylamino]acetyl]amino]propanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C(C)NC(=O)CNCc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C24H32N6O3/c1-17(24(32)28-15-19-2-6-20(7-3-19)23(25)26)29-22(31)16-27-14-18-4-8-21(9-5-18)30-10-12-33-13-11-30/h2-9,17,27H,10-16H2,1H3,(H3,25,26)(H,28,32)(H,29,31) |
| InChIKey | UVEIRUJWQAFYIR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 132.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|